C16H15FN4OS — CID 47049162
N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-4-thiophen-2-ylbutanamide (PubChem CID 47049162) has the molecular formula C16H15FN4OS and a molecular weight of 330.39 g/mol. Its IUPAC name is N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 47049162 |
| Molecular Formula | C16H15FN4OS |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCCc1cccs1)Nc1ccc(-n2cncn2)c(F)c1 |
| InChI | InChI=1S/C16H15FN4OS/c17-14-9-12(6-7-15(14)21-11-18-10-19-21)20-16(22)5-1-3-13-4-2-8-23-13/h2,4,6-11H,1,3,5H2,(H,20,22) |
| InChIKey | OIYXLWNQIDSLKE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |