C18H19FN2O4S — CID 47049200
N-(3,4-dihydro-2H-chromen-4-yl)-5-(ethylsulfamoyl)-2-fluorobenzamide (PubChem CID 47049200) has the molecular formula C18H19FN2O4S and a molecular weight of 378.43 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-4-yl)-5-(ethylsulfamoyl)-2-fluorobenzamide.
| Compound Name | N-(3,4-dihydro-2H-chromen-4-yl)-5-(ethylsulfamoyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 47049200 |
| Molecular Formula | C18H19FN2O4S |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-4-yl)-5-(ethylsulfamoyl)-2-fluorobenzamide |
| SMILES | CCNS(=O)(=O)c1ccc(F)c(C(=O)NC2CCOc3ccccc32)c1 |
| InChI | InChI=1S/C18H19FN2O4S/c1-2-20-26(23,24)12-7-8-15(19)14(11-12)18(22)21-16-9-10-25-17-6-4-3-5-13(16)17/h3-8,11,16,20H,2,9-10H2,1H3,(H,21,22) |
| InChIKey | CKTPQRSCTRAESN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |