C22H15Cl2N3O3S — CID 4704991
1-(3,4-dichlorophenyl)-6,7-dimethyl-2-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4704991) has the molecular formula C22H15Cl2N3O3S and a molecular weight of 472.35 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-6,7-dimethyl-2-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(3,4-dichlorophenyl)-6,7-dimethyl-2-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4704991 |
| Molecular Formula | C22H15Cl2N3O3S |
| Molecular Weight | 472.35 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-6,7-dimethyl-2-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | Cc1nnc(N2C(=O)c3oc4cc(C)c(C)cc4c(=O)c3C2c2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C22H15Cl2N3O3S/c1-9-6-13-16(7-10(9)2)30-20-17(19(13)28)18(12-4-5-14(23)15(24)8-12)27(21(20)29)22-26-25-11(3)31-22/h4-8,18H,1-3H3 |
| InChIKey | FEXGXQMDLVFUTB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.35 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |