C21H22N4O4S — CID 47050413
1-(2-benzylsulfonylethyl)-3-[3-[(2-oxopyrimidin-1-yl)methyl]phenyl]urea (PubChem CID 47050413) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is 1-(2-benzylsulfonylethyl)-3-[3-[(2-oxopyrimidin-1-yl)methyl]phenyl]urea.
| Compound Name | 1-(2-benzylsulfonylethyl)-3-[3-[(2-oxopyrimidin-1-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 47050413 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 1-(2-benzylsulfonylethyl)-3-[3-[(2-oxopyrimidin-1-yl)methyl]phenyl]urea |
| SMILES | O=C(NCCS(=O)(=O)Cc1ccccc1)Nc1cccc(Cn2cccnc2=O)c1 |
| InChI | InChI=1S/C21H22N4O4S/c26-20(22-11-13-30(28,29)16-17-6-2-1-3-7-17)24-19-9-4-8-18(14-19)15-25-12-5-10-23-21(25)27/h1-10,12,14H,11,13,15-16H2,(H2,22,24,26) |
| InChIKey | IGBYUWFBXVWRSD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |