About 1-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-N-[(5-methylfuran-2-yl)methyl]methanamine
1-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-N-[(5-methylfuran-2-yl)methyl]methanamine (PubChem CID 47052518) has the molecular formula C17H20N4O
and a molecular weight of 296.37 g/mol. Its IUPAC name is 1-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-N-[(5-methylfuran-2-yl)methyl]methanamine.
Molecular Properties
| Compound Name | 1-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-N-[(5-methylfuran-2-yl)methyl]methanamine |
| PubChem CID | 47052518 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 1-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-N-[(5-methylfuran-2-yl)methyl]methanamine |
| SMILES | Cc1cc(C)n(-c2ccc(CNCc3ccc(C)o3)cn2)n1 |
| InChI | InChI=1S/C17H20N4O/c1-12-8-13(2)21(20-12)17-7-5-15(10-19-17)9-18-11-16-6-4-14(3)22-16/h4-8,10,18H,9,11H2,1-3H3 |
| InChIKey | HFRUYSVLERAGJA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-N-[(5-methylfuran-2-yl)methyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-N-[(5-methylfuran-2-yl)methyl]methanamine?
The IUPAC name of 1-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-N-[(5-methylfuran-2-yl)methyl]methanamine (CID 47052518) is 1-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-N-[(5-methylfuran-2-yl)methyl]methanamine.
What is the SMILES notation for 1-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-N-[(5-methylfuran-2-yl)methyl]methanamine?
The canonical SMILES for 1-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-N-[(5-methylfuran-2-yl)methyl]methanamine is Cc1cc(C)n(-c2ccc(CNCc3ccc(C)o3)cn2)n1.
What is the InChIKey of 1-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-N-[(5-methylfuran-2-yl)methyl]methanamine?
The InChIKey is HFRUYSVLERAGJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4O/c1-12-8-13(2)21(20-12)17-7-5-15(10-19-17)9-18-11-16-6-4-14(3)22-16/h4-8,10,18H,9,11H2,1-3H3.
What are the key properties of 1-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-N-[(5-methylfuran-2-yl)methyl]methanamine?
1-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-N-[(5-methylfuran-2-yl)methyl]methanamine has a molecular weight of 296.37 g/mol, XLogP of 3.08, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-N-[(5-methylfuran-2-yl)methyl]methanamine is sourced from PubChem (CID 47052518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).