About N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-1-(4-morpholin-4-ylphenyl)methanamine
N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-1-(4-morpholin-4-ylphenyl)methanamine (PubChem CID 47053405) has the molecular formula C19H28N4O2
and a molecular weight of 344.46 g/mol. Its IUPAC name is N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-1-(4-morpholin-4-ylphenyl)methanamine.
Molecular Properties
| Compound Name | N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-1-(4-morpholin-4-ylphenyl)methanamine |
| PubChem CID | 47053405 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-1-(4-morpholin-4-ylphenyl)methanamine |
| SMILES | CN(Cc1ccc(N2CCOCC2)cc1)Cc1noc(C(C)(C)C)n1 |
| InChI | InChI=1S/C19H28N4O2/c1-19(2,3)18-20-17(21-25-18)14-22(4)13-15-5-7-16(8-6-15)23-9-11-24-12-10-23/h5-8H,9-14H2,1-4H3 |
| InChIKey | LPDBTVIJUVPMSX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 54.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-1-(4-morpholin-4-ylphenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-1-(4-morpholin-4-ylphenyl)methanamine?
The IUPAC name of N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-1-(4-morpholin-4-ylphenyl)methanamine (CID 47053405) is N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-1-(4-morpholin-4-ylphenyl)methanamine.
What is the SMILES notation for N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-1-(4-morpholin-4-ylphenyl)methanamine?
The canonical SMILES for N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-1-(4-morpholin-4-ylphenyl)methanamine is CN(Cc1ccc(N2CCOCC2)cc1)Cc1noc(C(C)(C)C)n1.
What is the InChIKey of N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-1-(4-morpholin-4-ylphenyl)methanamine?
The InChIKey is LPDBTVIJUVPMSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N4O2/c1-19(2,3)18-20-17(21-25-18)14-22(4)13-15-5-7-16(8-6-15)23-9-11-24-12-10-23/h5-8H,9-14H2,1-4H3.
What are the key properties of N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-1-(4-morpholin-4-ylphenyl)methanamine?
N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-1-(4-morpholin-4-ylphenyl)methanamine has a molecular weight of 344.46 g/mol, XLogP of 2.84, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-1-(4-morpholin-4-ylphenyl)methanamine is sourced from PubChem (CID 47053405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).