About 1-[2-[2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxamide
1-[2-[2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxamide (PubChem CID 47053801) has the molecular formula C16H24N4O3
and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-[2-[2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[2-[2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxamide |
| PubChem CID | 47053801 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 1-[2-[2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxamide |
| SMILES | Cc1cc(C2CCCN2CC(=O)N2CCC(C(N)=O)CC2)on1 |
| InChI | InChI=1S/C16H24N4O3/c1-11-9-14(23-18-11)13-3-2-6-20(13)10-15(21)19-7-4-12(5-8-19)16(17)22/h9,12-13H,2-8,10H2,1H3,(H2,17,22) |
| InChIKey | LHAJLXDLIWXEGX-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-[2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxamide?
The IUPAC name of 1-[2-[2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxamide (CID 47053801) is 1-[2-[2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxamide.
What is the SMILES notation for 1-[2-[2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxamide?
The canonical SMILES for 1-[2-[2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxamide is Cc1cc(C2CCCN2CC(=O)N2CCC(C(N)=O)CC2)on1.
What is the InChIKey of 1-[2-[2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxamide?
The InChIKey is LHAJLXDLIWXEGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4O3/c1-11-9-14(23-18-11)13-3-2-6-20(13)10-15(21)19-7-4-12(5-8-19)16(17)22/h9,12-13H,2-8,10H2,1H3,(H2,17,22).
What are the key properties of 1-[2-[2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxamide?
1-[2-[2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxamide has a molecular weight of 320.39 g/mol, XLogP of 0.84, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxamide is sourced from PubChem (CID 47053801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).