C17H22N4O5S — CID 47053832
N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-5-nitroquinolin-6-amine (PubChem CID 47053832) has the molecular formula C17H22N4O5S and a molecular weight of 394.45 g/mol. Its IUPAC name is N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-5-nitroquinolin-6-amine.
| Compound Name | N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-5-nitroquinolin-6-amine |
|---|---|
| PubChem CID | 47053832 |
| Molecular Formula | C17H22N4O5S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-5-nitroquinolin-6-amine |
| SMILES | CC1CN(S(=O)(=O)CCNc2ccc3ncccc3c2[N+](=O)[O-])CC(C)O1 |
| InChI | InChI=1S/C17H22N4O5S/c1-12-10-20(11-13(2)26-12)27(24,25)9-8-19-16-6-5-15-14(4-3-7-18-15)17(16)21(22)23/h3-7,12-13,19H,8-11H2,1-2H3 |
| InChIKey | JAZCQRJVSQWHPJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|