C20H23N3O3 — CID 47053984
2-methyl-N-[1-(3-methyl-4-nitrophenyl)piperidin-4-yl]benzamide (PubChem CID 47053984) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 2-methyl-N-[1-(3-methyl-4-nitrophenyl)piperidin-4-yl]benzamide.
| Compound Name | 2-methyl-N-[1-(3-methyl-4-nitrophenyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 47053984 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 2-methyl-N-[1-(3-methyl-4-nitrophenyl)piperidin-4-yl]benzamide |
| SMILES | Cc1ccccc1C(=O)NC1CCN(c2ccc([N+](=O)[O-])c(C)c2)CC1 |
| InChI | InChI=1S/C20H23N3O3/c1-14-5-3-4-6-18(14)20(24)21-16-9-11-22(12-10-16)17-7-8-19(23(25)26)15(2)13-17/h3-8,13,16H,9-12H2,1-2H3,(H,21,24) |
| InChIKey | YKGPCZXFCQMJCD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|