About 3-chloro-N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-(trifluoromethyl)pyridin-2-amine
3-chloro-N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 47054431) has the molecular formula C14H16ClF3N2O2
and a molecular weight of 336.74 g/mol. Its IUPAC name is 3-chloro-N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-(trifluoromethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 3-chloro-N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-(trifluoromethyl)pyridin-2-amine |
| PubChem CID | 47054431 |
| Molecular Formula | C14H16ClF3N2O2 |
| Molecular Weight | 336.74 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 3-chloro-N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cnc(NC2CCC3(CC2)OCCO3)c(Cl)c1 |
| InChI | InChI=1S/C14H16ClF3N2O2/c15-11-7-9(14(16,17)18)8-19-12(11)20-10-1-3-13(4-2-10)21-5-6-22-13/h7-8,10H,1-6H2,(H,19,20) |
| InChIKey | ZRPBMGSFTCGDTL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.74 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-(trifluoromethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-(trifluoromethyl)pyridin-2-amine?
The IUPAC name of 3-chloro-N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-(trifluoromethyl)pyridin-2-amine (CID 47054431) is 3-chloro-N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-(trifluoromethyl)pyridin-2-amine.
What is the SMILES notation for 3-chloro-N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-(trifluoromethyl)pyridin-2-amine?
The canonical SMILES for 3-chloro-N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-(trifluoromethyl)pyridin-2-amine is FC(F)(F)c1cnc(NC2CCC3(CC2)OCCO3)c(Cl)c1.
What is the InChIKey of 3-chloro-N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-(trifluoromethyl)pyridin-2-amine?
The InChIKey is ZRPBMGSFTCGDTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClF3N2O2/c15-11-7-9(14(16,17)18)8-19-12(11)20-10-1-3-13(4-2-10)21-5-6-22-13/h7-8,10H,1-6H2,(H,19,20).
What are the key properties of 3-chloro-N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-(trifluoromethyl)pyridin-2-amine?
3-chloro-N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-(trifluoromethyl)pyridin-2-amine has a molecular weight of 336.74 g/mol, XLogP of 3.85, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-(trifluoromethyl)pyridin-2-amine is sourced from PubChem (CID 47054431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).