C21H26N4O2 — CID 47054902
5,5-dimethyl-3-[3-(1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)propyl]imidazolidine-2,4-dione (PubChem CID 47054902) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 5,5-dimethyl-3-[3-(1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)propyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[3-(1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 47054902 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 5,5-dimethyl-3-[3-(1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)propyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CCCN2CCn3cccc3C2c2ccccc2)C1=O |
| InChI | InChI=1S/C21H26N4O2/c1-21(2)19(26)25(20(27)22-21)13-7-12-24-15-14-23-11-6-10-17(23)18(24)16-8-4-3-5-9-16/h3-6,8-11,18H,7,12-15H2,1-2H3,(H,22,27) |
| InChIKey | GOFNJMDEASYZKN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|