C17H15N5O2S — CID 47055025
12-(2,3-dihydro-1,4-benzoxazin-4-ylmethyl)-8-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one (PubChem CID 47055025) has the molecular formula C17H15N5O2S and a molecular weight of 353.41 g/mol. Its IUPAC name is 12-(2,3-dihydro-1,4-benzoxazin-4-ylmethyl)-8-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one.
| Compound Name | 12-(2,3-dihydro-1,4-benzoxazin-4-ylmethyl)-8-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
|---|---|
| PubChem CID | 47055025 |
| Molecular Formula | C17H15N5O2S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 12-(2,3-dihydro-1,4-benzoxazin-4-ylmethyl)-8-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
| SMILES | Cn1c(=O)c2sccc2n2c(CN3CCOc4ccccc43)nnc12 |
| InChI | InChI=1S/C17H15N5O2S/c1-20-16(23)15-12(6-9-25-15)22-14(18-19-17(20)22)10-21-7-8-24-13-5-3-2-4-11(13)21/h2-6,9H,7-8,10H2,1H3 |
| InChIKey | MAQWNOSLUVFROL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |