C20H22N4O — CID 47055802
2-[4-(2-cyanophenyl)-1,4-diazepan-1-yl]-2-phenylacetamide (PubChem CID 47055802) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-[4-(2-cyanophenyl)-1,4-diazepan-1-yl]-2-phenylacetamide.
| Compound Name | 2-[4-(2-cyanophenyl)-1,4-diazepan-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 47055802 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-[4-(2-cyanophenyl)-1,4-diazepan-1-yl]-2-phenylacetamide |
| SMILES | N#Cc1ccccc1N1CCCN(C(C(N)=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H22N4O/c21-15-17-9-4-5-10-18(17)23-11-6-12-24(14-13-23)19(20(22)25)16-7-2-1-3-8-16/h1-5,7-10,19H,6,11-14H2,(H2,22,25) |
| InChIKey | AJCXPSHQFPKQAH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 73.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |