C21H25N3O4 — CID 47056683
(3-methoxy-4-methylphenyl)-[4-[1-(3-nitrophenyl)ethyl]piperazin-1-yl]methanone (PubChem CID 47056683) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is (3-methoxy-4-methylphenyl)-[4-[1-(3-nitrophenyl)ethyl]piperazin-1-yl]methanone.
| Compound Name | (3-methoxy-4-methylphenyl)-[4-[1-(3-nitrophenyl)ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 47056683 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (3-methoxy-4-methylphenyl)-[4-[1-(3-nitrophenyl)ethyl]piperazin-1-yl]methanone |
| SMILES | COc1cc(C(=O)N2CCN(C(C)c3cccc([N+](=O)[O-])c3)CC2)ccc1C |
| InChI | InChI=1S/C21H25N3O4/c1-15-7-8-18(14-20(15)28-3)21(25)23-11-9-22(10-12-23)16(2)17-5-4-6-19(13-17)24(26)27/h4-8,13-14,16H,9-12H2,1-3H3 |
| InChIKey | KDQDUPUMBHMRRV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|