About 4-[(2,6-dichlorophenoxy)methyl]-2-pyrimidin-2-yl-1,3-thiazole
4-[(2,6-dichlorophenoxy)methyl]-2-pyrimidin-2-yl-1,3-thiazole (PubChem CID 47057574) has the molecular formula C14H9Cl2N3OS
and a molecular weight of 338.22 g/mol. Its IUPAC name is 4-[(2,6-dichlorophenoxy)methyl]-2-pyrimidin-2-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 4-[(2,6-dichlorophenoxy)methyl]-2-pyrimidin-2-yl-1,3-thiazole |
| PubChem CID | 47057574 |
| Molecular Formula | C14H9Cl2N3OS |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 4-[(2,6-dichlorophenoxy)methyl]-2-pyrimidin-2-yl-1,3-thiazole |
| SMILES | Clc1cccc(Cl)c1OCc1csc(-c2ncccn2)n1 |
| InChI | InChI=1S/C14H9Cl2N3OS/c15-10-3-1-4-11(16)12(10)20-7-9-8-21-14(19-9)13-17-5-2-6-18-13/h1-6,8H,7H2 |
| InChIKey | CKPRDDPMZKYXPC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2,6-dichlorophenoxy)methyl]-2-pyrimidin-2-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,6-dichlorophenoxy)methyl]-2-pyrimidin-2-yl-1,3-thiazole?
The IUPAC name of 4-[(2,6-dichlorophenoxy)methyl]-2-pyrimidin-2-yl-1,3-thiazole (CID 47057574) is 4-[(2,6-dichlorophenoxy)methyl]-2-pyrimidin-2-yl-1,3-thiazole.
What is the SMILES notation for 4-[(2,6-dichlorophenoxy)methyl]-2-pyrimidin-2-yl-1,3-thiazole?
The canonical SMILES for 4-[(2,6-dichlorophenoxy)methyl]-2-pyrimidin-2-yl-1,3-thiazole is Clc1cccc(Cl)c1OCc1csc(-c2ncccn2)n1.
What is the InChIKey of 4-[(2,6-dichlorophenoxy)methyl]-2-pyrimidin-2-yl-1,3-thiazole?
The InChIKey is CKPRDDPMZKYXPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Cl2N3OS/c15-10-3-1-4-11(16)12(10)20-7-9-8-21-14(19-9)13-17-5-2-6-18-13/h1-6,8H,7H2.
What are the key properties of 4-[(2,6-dichlorophenoxy)methyl]-2-pyrimidin-2-yl-1,3-thiazole?
4-[(2,6-dichlorophenoxy)methyl]-2-pyrimidin-2-yl-1,3-thiazole has a molecular weight of 338.22 g/mol, XLogP of 4.49, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-dichlorophenoxy)methyl]-2-pyrimidin-2-yl-1,3-thiazole is sourced from PubChem (CID 47057574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).