About [4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-(4-fluorophenyl)methanone
[4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-(4-fluorophenyl)methanone (PubChem CID 47059403) has the molecular formula C20H15FN4O2
and a molecular weight of 362.36 g/mol. Its IUPAC name is [4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-(4-fluorophenyl)methanone.
Molecular Properties
| Compound Name | [4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-(4-fluorophenyl)methanone |
| PubChem CID | 47059403 |
| Molecular Formula | C20H15FN4O2 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | [4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-(4-fluorophenyl)methanone |
| SMILES | Cc1nc(Oc2ccc(C(=O)c3ccc(F)cc3)cc2)c2cnn(C)c2n1 |
| InChI | InChI=1S/C20H15FN4O2/c1-12-23-19-17(11-22-25(19)2)20(24-12)27-16-9-5-14(6-10-16)18(26)13-3-7-15(21)8-4-13/h3-11H,1-2H3 |
| InChIKey | TWRPITOFBYALSV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-(4-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-(4-fluorophenyl)methanone?
The IUPAC name of [4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-(4-fluorophenyl)methanone (CID 47059403) is [4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-(4-fluorophenyl)methanone.
What is the SMILES notation for [4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-(4-fluorophenyl)methanone?
The canonical SMILES for [4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-(4-fluorophenyl)methanone is Cc1nc(Oc2ccc(C(=O)c3ccc(F)cc3)cc2)c2cnn(C)c2n1.
What is the InChIKey of [4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-(4-fluorophenyl)methanone?
The InChIKey is TWRPITOFBYALSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15FN4O2/c1-12-23-19-17(11-22-25(19)2)20(24-12)27-16-9-5-14(6-10-16)18(26)13-3-7-15(21)8-4-13/h3-11H,1-2H3.
What are the key properties of [4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-(4-fluorophenyl)methanone?
[4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-(4-fluorophenyl)methanone has a molecular weight of 362.36 g/mol, XLogP of 3.83, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-(4-fluorophenyl)methanone is sourced from PubChem (CID 47059403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).