C12H9F2N3O3 — CID 47059552
N-(3,5-difluoro-4-methoxyphenyl)-3-nitropyridin-2-amine (PubChem CID 47059552) has the molecular formula C12H9F2N3O3 and a molecular weight of 281.22 g/mol. Its IUPAC name is N-(3,5-difluoro-4-methoxyphenyl)-3-nitropyridin-2-amine.
| Compound Name | N-(3,5-difluoro-4-methoxyphenyl)-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 47059552 |
| Molecular Formula | C12H9F2N3O3 |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | N-(3,5-difluoro-4-methoxyphenyl)-3-nitropyridin-2-amine |
| SMILES | COc1c(F)cc(Nc2ncccc2[N+](=O)[O-])cc1F |
| InChI | InChI=1S/C12H9F2N3O3/c1-20-11-8(13)5-7(6-9(11)14)16-12-10(17(18)19)3-2-4-15-12/h2-6H,1H3,(H,15,16) |
| InChIKey | MPLHHGQCDRYYJW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|