C15H19N3O3S — CID 47059744
1-cyclopentyl-3-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4,5-trione (PubChem CID 47059744) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-cyclopentyl-3-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-cyclopentyl-3-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 47059744 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-cyclopentyl-3-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4,5-trione |
| SMILES | CC(C)c1nc(CN2C(=O)C(=O)N(C3CCCC3)C2=O)cs1 |
| InChI | InChI=1S/C15H19N3O3S/c1-9(2)12-16-10(8-22-12)7-17-13(19)14(20)18(15(17)21)11-5-3-4-6-11/h8-9,11H,3-7H2,1-2H3 |
| InChIKey | NSRHVVDBUHECBU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|