About 4-N-(3-bromophenyl)-7-N-methylquinazoline-4,6,7-triamine
4-N-(3-bromophenyl)-7-N-methylquinazoline-4,6,7-triamine (PubChem CID 4706) has the molecular formula C15H14BrN5
and a molecular weight of 344.22 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)-7-N-methylquinazoline-4,6,7-triamine.
Molecular Properties
| Compound Name | 4-N-(3-bromophenyl)-7-N-methylquinazoline-4,6,7-triamine |
| PubChem CID | 4706 |
| Molecular Formula | C15H14BrN5 |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 4-N-(3-bromophenyl)-7-N-methylquinazoline-4,6,7-triamine |
| SMILES | CNc1cc2ncnc(Nc3cccc(Br)c3)c2cc1N |
| InChI | InChI=1S/C15H14BrN5/c1-18-14-7-13-11(6-12(14)17)15(20-8-19-13)21-10-4-2-3-9(16)5-10/h2-8,18H,17H2,1H3,(H,19,20,21) |
| InChIKey | WUWMKQIRTKOCMN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(3-bromophenyl)-7-N-methylquinazoline-4,6,7-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(3-bromophenyl)-7-N-methylquinazoline-4,6,7-triamine?
The IUPAC name of 4-N-(3-bromophenyl)-7-N-methylquinazoline-4,6,7-triamine (CID 4706) is 4-N-(3-bromophenyl)-7-N-methylquinazoline-4,6,7-triamine.
What is the SMILES notation for 4-N-(3-bromophenyl)-7-N-methylquinazoline-4,6,7-triamine?
The canonical SMILES for 4-N-(3-bromophenyl)-7-N-methylquinazoline-4,6,7-triamine is CNc1cc2ncnc(Nc3cccc(Br)c3)c2cc1N.
What is the InChIKey of 4-N-(3-bromophenyl)-7-N-methylquinazoline-4,6,7-triamine?
The InChIKey is WUWMKQIRTKOCMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14BrN5/c1-18-14-7-13-11(6-12(14)17)15(20-8-19-13)21-10-4-2-3-9(16)5-10/h2-8,18H,17H2,1H3,(H,19,20,21).
What are the key properties of 4-N-(3-bromophenyl)-7-N-methylquinazoline-4,6,7-triamine?
4-N-(3-bromophenyl)-7-N-methylquinazoline-4,6,7-triamine has a molecular weight of 344.22 g/mol, XLogP of 3.76, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(3-bromophenyl)-7-N-methylquinazoline-4,6,7-triamine is sourced from PubChem (CID 4706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).