C21H33N3O — CID 47060175
3-[4-(cyclohexylmethyl)-1,4-diazepan-1-yl]-N-phenylpropanamide (PubChem CID 47060175) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is 3-[4-(cyclohexylmethyl)-1,4-diazepan-1-yl]-N-phenylpropanamide.
| Compound Name | 3-[4-(cyclohexylmethyl)-1,4-diazepan-1-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 47060175 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | 3-[4-(cyclohexylmethyl)-1,4-diazepan-1-yl]-N-phenylpropanamide |
| SMILES | O=C(CCN1CCCN(CC2CCCCC2)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C21H33N3O/c25-21(22-20-10-5-2-6-11-20)12-15-23-13-7-14-24(17-16-23)18-19-8-3-1-4-9-19/h2,5-6,10-11,19H,1,3-4,7-9,12-18H2,(H,22,25) |
| InChIKey | GNYIVXMQJLQEPB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |