About 4-[2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl]phenol
4-[2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl]phenol (PubChem CID 47060280) has the molecular formula C14H13N3OS
and a molecular weight of 271.35 g/mol. Its IUPAC name is 4-[2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl]phenol.
Molecular Properties
| Compound Name | 4-[2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl]phenol |
| PubChem CID | 47060280 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 4-[2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl]phenol |
| SMILES | Oc1ccc(CCNc2ncnc3sccc23)cc1 |
| InChI | InChI=1S/C14H13N3OS/c18-11-3-1-10(2-4-11)5-7-15-13-12-6-8-19-14(12)17-9-16-13/h1-4,6,8-9,18H,5,7H2,(H,15,16,17) |
| InChIKey | FQQSEYJLMXBYNI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl]phenol?
The IUPAC name of 4-[2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl]phenol (CID 47060280) is 4-[2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl]phenol.
What is the SMILES notation for 4-[2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl]phenol?
The canonical SMILES for 4-[2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl]phenol is Oc1ccc(CCNc2ncnc3sccc23)cc1.
What is the InChIKey of 4-[2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl]phenol?
The InChIKey is FQQSEYJLMXBYNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3OS/c18-11-3-1-10(2-4-11)5-7-15-13-12-6-8-19-14(12)17-9-16-13/h1-4,6,8-9,18H,5,7H2,(H,15,16,17).
What are the key properties of 4-[2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl]phenol?
4-[2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl]phenol has a molecular weight of 271.35 g/mol, XLogP of 3.05, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl]phenol is sourced from PubChem (CID 47060280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).