About ethyl 4-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)sulfonyl]piperazine-1-carboxylate
ethyl 4-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)sulfonyl]piperazine-1-carboxylate (PubChem CID 47060356) has the molecular formula C15H23N3O4S2
and a molecular weight of 373.50 g/mol. Its IUPAC name is ethyl 4-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)sulfonyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)sulfonyl]piperazine-1-carboxylate |
| PubChem CID | 47060356 |
| Molecular Formula | C15H23N3O4S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | ethyl 4-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)sulfonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)N2CCc3sccc3C2C)CC1 |
| InChI | InChI=1S/C15H23N3O4S2/c1-3-22-15(19)16-7-9-17(10-8-16)24(20,21)18-6-4-14-13(12(18)2)5-11-23-14/h5,11-12H,3-4,6-10H2,1-2H3 |
| InChIKey | ORWLQOGDXYPJIF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)sulfonyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)sulfonyl]piperazine-1-carboxylate?
The IUPAC name of ethyl 4-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)sulfonyl]piperazine-1-carboxylate (CID 47060356) is ethyl 4-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)sulfonyl]piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)sulfonyl]piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)sulfonyl]piperazine-1-carboxylate is CCOC(=O)N1CCN(S(=O)(=O)N2CCc3sccc3C2C)CC1.
What is the InChIKey of ethyl 4-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)sulfonyl]piperazine-1-carboxylate?
The InChIKey is ORWLQOGDXYPJIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O4S2/c1-3-22-15(19)16-7-9-17(10-8-16)24(20,21)18-6-4-14-13(12(18)2)5-11-23-14/h5,11-12H,3-4,6-10H2,1-2H3.
What are the key properties of ethyl 4-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)sulfonyl]piperazine-1-carboxylate?
ethyl 4-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)sulfonyl]piperazine-1-carboxylate has a molecular weight of 373.50 g/mol, XLogP of 1.69, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)sulfonyl]piperazine-1-carboxylate is sourced from PubChem (CID 47060356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).