C21H28N4S — CID 47060553
N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-(4-piperidin-1-ylphenyl)ethanamine (PubChem CID 47060553) has the molecular formula C21H28N4S and a molecular weight of 368.55 g/mol. Its IUPAC name is N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-(4-piperidin-1-ylphenyl)ethanamine.
| Compound Name | N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-(4-piperidin-1-ylphenyl)ethanamine |
|---|---|
| PubChem CID | 47060553 |
| Molecular Formula | C21H28N4S |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-(4-piperidin-1-ylphenyl)ethanamine |
| SMILES | Cc1cn2c(CNCCc3ccc(N4CCCCC4)cc3)c(C)nc2s1 |
| InChI | InChI=1S/C21H28N4S/c1-16-15-25-20(17(2)23-21(25)26-16)14-22-11-10-18-6-8-19(9-7-18)24-12-4-3-5-13-24/h6-9,15,22H,3-5,10-14H2,1-2H3 |
| InChIKey | SULAEFLLNOWDTE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|