About 3-[[4-(2-methylpropoxy)piperidin-1-yl]methyl]-5-nitro-1,3-benzoxazol-2-one
3-[[4-(2-methylpropoxy)piperidin-1-yl]methyl]-5-nitro-1,3-benzoxazol-2-one (PubChem CID 47060803) has the molecular formula C17H23N3O5
and a molecular weight of 349.39 g/mol. Its IUPAC name is 3-[[4-(2-methylpropoxy)piperidin-1-yl]methyl]-5-nitro-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 3-[[4-(2-methylpropoxy)piperidin-1-yl]methyl]-5-nitro-1,3-benzoxazol-2-one |
| PubChem CID | 47060803 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 3-[[4-(2-methylpropoxy)piperidin-1-yl]methyl]-5-nitro-1,3-benzoxazol-2-one |
| SMILES | CC(C)COC1CCN(Cn2c(=O)oc3ccc([N+](=O)[O-])cc32)CC1 |
| InChI | InChI=1S/C17H23N3O5/c1-12(2)10-24-14-5-7-18(8-6-14)11-19-15-9-13(20(22)23)3-4-16(15)25-17(19)21/h3-4,9,12,14H,5-8,10-11H2,1-2H3 |
| InChIKey | OWUXESFHPXRDKM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 90.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-(2-methylpropoxy)piperidin-1-yl]methyl]-5-nitro-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(2-methylpropoxy)piperidin-1-yl]methyl]-5-nitro-1,3-benzoxazol-2-one?
The IUPAC name of 3-[[4-(2-methylpropoxy)piperidin-1-yl]methyl]-5-nitro-1,3-benzoxazol-2-one (CID 47060803) is 3-[[4-(2-methylpropoxy)piperidin-1-yl]methyl]-5-nitro-1,3-benzoxazol-2-one.
What is the SMILES notation for 3-[[4-(2-methylpropoxy)piperidin-1-yl]methyl]-5-nitro-1,3-benzoxazol-2-one?
The canonical SMILES for 3-[[4-(2-methylpropoxy)piperidin-1-yl]methyl]-5-nitro-1,3-benzoxazol-2-one is CC(C)COC1CCN(Cn2c(=O)oc3ccc([N+](=O)[O-])cc32)CC1.
What is the InChIKey of 3-[[4-(2-methylpropoxy)piperidin-1-yl]methyl]-5-nitro-1,3-benzoxazol-2-one?
The InChIKey is OWUXESFHPXRDKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O5/c1-12(2)10-24-14-5-7-18(8-6-14)11-19-15-9-13(20(22)23)3-4-16(15)25-17(19)21/h3-4,9,12,14H,5-8,10-11H2,1-2H3.
What are the key properties of 3-[[4-(2-methylpropoxy)piperidin-1-yl]methyl]-5-nitro-1,3-benzoxazol-2-one?
3-[[4-(2-methylpropoxy)piperidin-1-yl]methyl]-5-nitro-1,3-benzoxazol-2-one has a molecular weight of 349.39 g/mol, XLogP of 2.60, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(2-methylpropoxy)piperidin-1-yl]methyl]-5-nitro-1,3-benzoxazol-2-one is sourced from PubChem (CID 47060803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).