About 3-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]benzoic acid
3-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]benzoic acid (PubChem CID 47061902) has the molecular formula C17H13NO3S
and a molecular weight of 311.36 g/mol. Its IUPAC name is 3-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 3-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]benzoic acid |
| PubChem CID | 47061902 |
| Molecular Formula | C17H13NO3S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 3-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]benzoic acid |
| SMILES | COc1ccccc1-c1csc(-c2cccc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C17H13NO3S/c1-21-15-8-3-2-7-13(15)14-10-22-16(18-14)11-5-4-6-12(9-11)17(19)20/h2-10H,1H3,(H,19,20) |
| InChIKey | NDOGHBIQYAOBPG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]benzoic acid?
The IUPAC name of 3-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]benzoic acid (CID 47061902) is 3-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]benzoic acid.
What is the SMILES notation for 3-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]benzoic acid?
The canonical SMILES for 3-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]benzoic acid is COc1ccccc1-c1csc(-c2cccc(C(=O)O)c2)n1.
What is the InChIKey of 3-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]benzoic acid?
The InChIKey is NDOGHBIQYAOBPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO3S/c1-21-15-8-3-2-7-13(15)14-10-22-16(18-14)11-5-4-6-12(9-11)17(19)20/h2-10H,1H3,(H,19,20).
What are the key properties of 3-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]benzoic acid?
3-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]benzoic acid has a molecular weight of 311.36 g/mol, XLogP of 4.18, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]benzoic acid is sourced from PubChem (CID 47061902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).