C17H22N4O2 — CID 47062510
6-acetamido-N-(3-imidazol-1-ylphenyl)hexanamide (PubChem CID 47062510) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 6-acetamido-N-(3-imidazol-1-ylphenyl)hexanamide.
| Compound Name | 6-acetamido-N-(3-imidazol-1-ylphenyl)hexanamide |
|---|---|
| PubChem CID | 47062510 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 6-acetamido-N-(3-imidazol-1-ylphenyl)hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)Nc1cccc(-n2ccnc2)c1 |
| InChI | InChI=1S/C17H22N4O2/c1-14(22)19-9-4-2-3-8-17(23)20-15-6-5-7-16(12-15)21-11-10-18-13-21/h5-7,10-13H,2-4,8-9H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | YVLGASFFMMFHJP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|