About N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]naphthalene-2-sulfonamide
N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]naphthalene-2-sulfonamide (PubChem CID 47063258) has the molecular formula C19H16N4O2S
and a molecular weight of 364.43 g/mol. Its IUPAC name is N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]naphthalene-2-sulfonamide.
Molecular Properties
| Compound Name | N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]naphthalene-2-sulfonamide |
| PubChem CID | 47063258 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1Cn1cncn1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H16N4O2S/c24-26(25,18-10-9-15-5-1-2-6-16(15)11-18)22-19-8-4-3-7-17(19)12-23-14-20-13-21-23/h1-11,13-14,22H,12H2 |
| InChIKey | PLPWSRPYLWZLFC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]naphthalene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]naphthalene-2-sulfonamide?
The IUPAC name of N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]naphthalene-2-sulfonamide (CID 47063258) is N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]naphthalene-2-sulfonamide.
What is the SMILES notation for N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]naphthalene-2-sulfonamide?
The canonical SMILES for N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]naphthalene-2-sulfonamide is O=S(=O)(Nc1ccccc1Cn1cncn1)c1ccc2ccccc2c1.
What is the InChIKey of N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]naphthalene-2-sulfonamide?
The InChIKey is PLPWSRPYLWZLFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O2S/c24-26(25,18-10-9-15-5-1-2-6-16(15)11-18)22-19-8-4-3-7-17(19)12-23-14-20-13-21-23/h1-11,13-14,22H,12H2.
What are the key properties of N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]naphthalene-2-sulfonamide?
N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]naphthalene-2-sulfonamide has a molecular weight of 364.43 g/mol, XLogP of 3.28, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]naphthalene-2-sulfonamide is sourced from PubChem (CID 47063258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).