C16H13F2N5O2 — CID 47063754
methyl 2,4-difluoro-5-[(1-phenyltetrazol-5-yl)methylamino]benzoate (PubChem CID 47063754) has the molecular formula C16H13F2N5O2 and a molecular weight of 345.31 g/mol. Its IUPAC name is methyl 2,4-difluoro-5-[(1-phenyltetrazol-5-yl)methylamino]benzoate.
| Compound Name | methyl 2,4-difluoro-5-[(1-phenyltetrazol-5-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 47063754 |
| Molecular Formula | C16H13F2N5O2 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | methyl 2,4-difluoro-5-[(1-phenyltetrazol-5-yl)methylamino]benzoate |
| SMILES | COC(=O)c1cc(NCc2nnnn2-c2ccccc2)c(F)cc1F |
| InChI | InChI=1S/C16H13F2N5O2/c1-25-16(24)11-7-14(13(18)8-12(11)17)19-9-15-20-21-22-23(15)10-5-3-2-4-6-10/h2-8,19H,9H2,1H3 |
| InChIKey | MSAMITIZWCZTPJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |