C18H19ClFN3O3 — CID 47064189
N-(5-chloro-2-fluorophenyl)-2-[3-[2-(dimethylamino)-2-oxoethoxy]anilino]acetamide (PubChem CID 47064189) has the molecular formula C18H19ClFN3O3 and a molecular weight of 379.82 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-2-[3-[2-(dimethylamino)-2-oxoethoxy]anilino]acetamide.
| Compound Name | N-(5-chloro-2-fluorophenyl)-2-[3-[2-(dimethylamino)-2-oxoethoxy]anilino]acetamide |
|---|---|
| PubChem CID | 47064189 |
| Molecular Formula | C18H19ClFN3O3 |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-2-[3-[2-(dimethylamino)-2-oxoethoxy]anilino]acetamide |
| SMILES | CN(C)C(=O)COc1cccc(NCC(=O)Nc2cc(Cl)ccc2F)c1 |
| InChI | InChI=1S/C18H19ClFN3O3/c1-23(2)18(25)11-26-14-5-3-4-13(9-14)21-10-17(24)22-16-8-12(19)6-7-15(16)20/h3-9,21H,10-11H2,1-2H3,(H,22,24) |
| InChIKey | VTCPJBLCCORJKB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |