C22H32FN5O2S — CID 47065148
1-[4-[(dipropylsulfamoylamino)methyl]-2-pyridinyl]-4-(4-fluorophenyl)piperazine (PubChem CID 47065148) has the molecular formula C22H32FN5O2S and a molecular weight of 449.60 g/mol. Its IUPAC name is 1-[4-[(dipropylsulfamoylamino)methyl]-2-pyridinyl]-4-(4-fluorophenyl)piperazine.
| Compound Name | 1-[4-[(dipropylsulfamoylamino)methyl]-2-pyridinyl]-4-(4-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 47065148 |
| Molecular Formula | C22H32FN5O2S |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 1-[4-[(dipropylsulfamoylamino)methyl]-2-pyridinyl]-4-(4-fluorophenyl)piperazine |
| SMILES | CCCN(CCC)S(=O)(=O)NCc1ccnc(N2CCN(c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C22H32FN5O2S/c1-3-11-28(12-4-2)31(29,30)25-18-19-9-10-24-22(17-19)27-15-13-26(14-16-27)21-7-5-20(23)6-8-21/h5-10,17,25H,3-4,11-16,18H2,1-2H3 |
| InChIKey | CATODKSGDPHPEX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |