About 4-[cyclopropyl-[(2,4-difluorophenyl)methyl]sulfamoyl]-1-methylpyrrole-2-carboxamide
4-[cyclopropyl-[(2,4-difluorophenyl)methyl]sulfamoyl]-1-methylpyrrole-2-carboxamide (PubChem CID 47065211) has the molecular formula C16H17F2N3O3S
and a molecular weight of 369.39 g/mol. Its IUPAC name is 4-[cyclopropyl-[(2,4-difluorophenyl)methyl]sulfamoyl]-1-methylpyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-[cyclopropyl-[(2,4-difluorophenyl)methyl]sulfamoyl]-1-methylpyrrole-2-carboxamide |
| PubChem CID | 47065211 |
| Molecular Formula | C16H17F2N3O3S |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 4-[cyclopropyl-[(2,4-difluorophenyl)methyl]sulfamoyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)N(Cc2ccc(F)cc2F)C2CC2)cc1C(N)=O |
| InChI | InChI=1S/C16H17F2N3O3S/c1-20-9-13(7-15(20)16(19)22)25(23,24)21(12-4-5-12)8-10-2-3-11(17)6-14(10)18/h2-3,6-7,9,12H,4-5,8H2,1H3,(H2,19,22) |
| InChIKey | FEDXYCARNLVOJV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[cyclopropyl-[(2,4-difluorophenyl)methyl]sulfamoyl]-1-methylpyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[cyclopropyl-[(2,4-difluorophenyl)methyl]sulfamoyl]-1-methylpyrrole-2-carboxamide?
The IUPAC name of 4-[cyclopropyl-[(2,4-difluorophenyl)methyl]sulfamoyl]-1-methylpyrrole-2-carboxamide (CID 47065211) is 4-[cyclopropyl-[(2,4-difluorophenyl)methyl]sulfamoyl]-1-methylpyrrole-2-carboxamide.
What is the SMILES notation for 4-[cyclopropyl-[(2,4-difluorophenyl)methyl]sulfamoyl]-1-methylpyrrole-2-carboxamide?
The canonical SMILES for 4-[cyclopropyl-[(2,4-difluorophenyl)methyl]sulfamoyl]-1-methylpyrrole-2-carboxamide is Cn1cc(S(=O)(=O)N(Cc2ccc(F)cc2F)C2CC2)cc1C(N)=O.
What is the InChIKey of 4-[cyclopropyl-[(2,4-difluorophenyl)methyl]sulfamoyl]-1-methylpyrrole-2-carboxamide?
The InChIKey is FEDXYCARNLVOJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F2N3O3S/c1-20-9-13(7-15(20)16(19)22)25(23,24)21(12-4-5-12)8-10-2-3-11(17)6-14(10)18/h2-3,6-7,9,12H,4-5,8H2,1H3,(H2,19,22).
What are the key properties of 4-[cyclopropyl-[(2,4-difluorophenyl)methyl]sulfamoyl]-1-methylpyrrole-2-carboxamide?
4-[cyclopropyl-[(2,4-difluorophenyl)methyl]sulfamoyl]-1-methylpyrrole-2-carboxamide has a molecular weight of 369.39 g/mol, XLogP of 1.76, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[cyclopropyl-[(2,4-difluorophenyl)methyl]sulfamoyl]-1-methylpyrrole-2-carboxamide is sourced from PubChem (CID 47065211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).