C16H19N7OS — CID 47065431
6-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethylsulfanylmethyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 47065431) has the molecular formula C16H19N7OS and a molecular weight of 357.44 g/mol. Its IUPAC name is 6-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethylsulfanylmethyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethylsulfanylmethyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 47065431 |
| Molecular Formula | C16H19N7OS |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 6-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethylsulfanylmethyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1noc(C(C)SCc2nc(N)nc(Nc3ccccc3C)n2)n1 |
| InChI | InChI=1S/C16H19N7OS/c1-9-6-4-5-7-12(9)19-16-21-13(20-15(17)22-16)8-25-10(2)14-18-11(3)23-24-14/h4-7,10H,8H2,1-3H3,(H3,17,19,20,21,22) |
| InChIKey | MUQGCAGECTXHDO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |