About (1-methylpyrazol-4-yl)methyl 1-propanoyl-2,3-dihydroindole-5-carboxylate
(1-methylpyrazol-4-yl)methyl 1-propanoyl-2,3-dihydroindole-5-carboxylate (PubChem CID 47065445) has the molecular formula C17H19N3O3
and a molecular weight of 313.36 g/mol. Its IUPAC name is (1-methylpyrazol-4-yl)methyl 1-propanoyl-2,3-dihydroindole-5-carboxylate.
Molecular Properties
| Compound Name | (1-methylpyrazol-4-yl)methyl 1-propanoyl-2,3-dihydroindole-5-carboxylate |
| PubChem CID | 47065445 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (1-methylpyrazol-4-yl)methyl 1-propanoyl-2,3-dihydroindole-5-carboxylate |
| SMILES | CCC(=O)N1CCc2cc(C(=O)OCc3cnn(C)c3)ccc21 |
| InChI | InChI=1S/C17H19N3O3/c1-3-16(21)20-7-6-13-8-14(4-5-15(13)20)17(22)23-11-12-9-18-19(2)10-12/h4-5,8-10H,3,6-7,11H2,1-2H3 |
| InChIKey | MXCHLWSHEBXGSF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-methylpyrazol-4-yl)methyl 1-propanoyl-2,3-dihydroindole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpyrazol-4-yl)methyl 1-propanoyl-2,3-dihydroindole-5-carboxylate?
The IUPAC name of (1-methylpyrazol-4-yl)methyl 1-propanoyl-2,3-dihydroindole-5-carboxylate (CID 47065445) is (1-methylpyrazol-4-yl)methyl 1-propanoyl-2,3-dihydroindole-5-carboxylate.
What is the SMILES notation for (1-methylpyrazol-4-yl)methyl 1-propanoyl-2,3-dihydroindole-5-carboxylate?
The canonical SMILES for (1-methylpyrazol-4-yl)methyl 1-propanoyl-2,3-dihydroindole-5-carboxylate is CCC(=O)N1CCc2cc(C(=O)OCc3cnn(C)c3)ccc21.
What is the InChIKey of (1-methylpyrazol-4-yl)methyl 1-propanoyl-2,3-dihydroindole-5-carboxylate?
The InChIKey is MXCHLWSHEBXGSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O3/c1-3-16(21)20-7-6-13-8-14(4-5-15(13)20)17(22)23-11-12-9-18-19(2)10-12/h4-5,8-10H,3,6-7,11H2,1-2H3.
What are the key properties of (1-methylpyrazol-4-yl)methyl 1-propanoyl-2,3-dihydroindole-5-carboxylate?
(1-methylpyrazol-4-yl)methyl 1-propanoyl-2,3-dihydroindole-5-carboxylate has a molecular weight of 313.36 g/mol, XLogP of 2.08, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpyrazol-4-yl)methyl 1-propanoyl-2,3-dihydroindole-5-carboxylate is sourced from PubChem (CID 47065445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).