C20H29N3O3 — CID 47066357
N-(1-cyclohexylbenzimidazol-2-yl)-2-(2-ethoxyethoxy)propanamide (PubChem CID 47066357) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is N-(1-cyclohexylbenzimidazol-2-yl)-2-(2-ethoxyethoxy)propanamide.
| Compound Name | N-(1-cyclohexylbenzimidazol-2-yl)-2-(2-ethoxyethoxy)propanamide |
|---|---|
| PubChem CID | 47066357 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N-(1-cyclohexylbenzimidazol-2-yl)-2-(2-ethoxyethoxy)propanamide |
| SMILES | CCOCCOC(C)C(=O)Nc1nc2ccccc2n1C1CCCCC1 |
| InChI | InChI=1S/C20H29N3O3/c1-3-25-13-14-26-15(2)19(24)22-20-21-17-11-7-8-12-18(17)23(20)16-9-5-4-6-10-16/h7-8,11-12,15-16H,3-6,9-10,13-14H2,1-2H3,(H,21,22,24) |
| InChIKey | VKSQXDFFYVBHSI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|