C14H15F3N4OS — CID 47066365
4-prop-2-enyl-5-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]-1,2,4-triazol-3-amine (PubChem CID 47066365) has the molecular formula C14H15F3N4OS and a molecular weight of 344.36 g/mol. Its IUPAC name is 4-prop-2-enyl-5-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]-1,2,4-triazol-3-amine.
| Compound Name | 4-prop-2-enyl-5-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 47066365 |
| Molecular Formula | C14H15F3N4OS |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 4-prop-2-enyl-5-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]-1,2,4-triazol-3-amine |
| SMILES | C=CCn1c(N)nnc1SCc1cccc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F3N4OS/c1-2-6-21-12(18)19-20-13(21)23-8-10-4-3-5-11(7-10)22-9-14(15,16)17/h2-5,7H,1,6,8-9H2,(H2,18,19) |
| InChIKey | FQQPCANLPYMTRY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|