C16H21N3O3S — CID 47066496
1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-3-cyclopentylimidazolidine-2,4,5-trione (PubChem CID 47066496) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-3-cyclopentylimidazolidine-2,4,5-trione.
| Compound Name | 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-3-cyclopentylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 47066496 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-3-cyclopentylimidazolidine-2,4,5-trione |
| SMILES | CC(C)(C)c1nc(CN2C(=O)C(=O)N(C3CCCC3)C2=O)cs1 |
| InChI | InChI=1S/C16H21N3O3S/c1-16(2,3)14-17-10(9-23-14)8-18-12(20)13(21)19(15(18)22)11-6-4-5-7-11/h9,11H,4-8H2,1-3H3 |
| InChIKey | QUBRWOZIKCFENR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|