About N-[(3-butyl-1,2,4-oxadiazol-5-yl)methyl]-2-methyl-5-(tetrazol-1-yl)aniline
N-[(3-butyl-1,2,4-oxadiazol-5-yl)methyl]-2-methyl-5-(tetrazol-1-yl)aniline (PubChem CID 47066552) has the molecular formula C15H19N7O
and a molecular weight of 313.37 g/mol. Its IUPAC name is N-[(3-butyl-1,2,4-oxadiazol-5-yl)methyl]-2-methyl-5-(tetrazol-1-yl)aniline.
Molecular Properties
| Compound Name | N-[(3-butyl-1,2,4-oxadiazol-5-yl)methyl]-2-methyl-5-(tetrazol-1-yl)aniline |
| PubChem CID | 47066552 |
| Molecular Formula | C15H19N7O |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-[(3-butyl-1,2,4-oxadiazol-5-yl)methyl]-2-methyl-5-(tetrazol-1-yl)aniline |
| SMILES | CCCCc1noc(CNc2cc(-n3cnnn3)ccc2C)n1 |
| InChI | InChI=1S/C15H19N7O/c1-3-4-5-14-18-15(23-19-14)9-16-13-8-12(7-6-11(13)2)22-10-17-20-21-22/h6-8,10,16H,3-5,9H2,1-2H3 |
| InChIKey | XYTRNKBMCKYMNT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-[(3-butyl-1,2,4-oxadiazol-5-yl)methyl]-2-methyl-5-(tetrazol-1-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-butyl-1,2,4-oxadiazol-5-yl)methyl]-2-methyl-5-(tetrazol-1-yl)aniline?
The IUPAC name of N-[(3-butyl-1,2,4-oxadiazol-5-yl)methyl]-2-methyl-5-(tetrazol-1-yl)aniline (CID 47066552) is N-[(3-butyl-1,2,4-oxadiazol-5-yl)methyl]-2-methyl-5-(tetrazol-1-yl)aniline.
What is the SMILES notation for N-[(3-butyl-1,2,4-oxadiazol-5-yl)methyl]-2-methyl-5-(tetrazol-1-yl)aniline?
The canonical SMILES for N-[(3-butyl-1,2,4-oxadiazol-5-yl)methyl]-2-methyl-5-(tetrazol-1-yl)aniline is CCCCc1noc(CNc2cc(-n3cnnn3)ccc2C)n1.
What is the InChIKey of N-[(3-butyl-1,2,4-oxadiazol-5-yl)methyl]-2-methyl-5-(tetrazol-1-yl)aniline?
The InChIKey is XYTRNKBMCKYMNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N7O/c1-3-4-5-14-18-15(23-19-14)9-16-13-8-12(7-6-11(13)2)22-10-17-20-21-22/h6-8,10,16H,3-5,9H2,1-2H3.
What are the key properties of N-[(3-butyl-1,2,4-oxadiazol-5-yl)methyl]-2-methyl-5-(tetrazol-1-yl)aniline?
N-[(3-butyl-1,2,4-oxadiazol-5-yl)methyl]-2-methyl-5-(tetrazol-1-yl)aniline has a molecular weight of 313.37 g/mol, XLogP of 2.31, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-butyl-1,2,4-oxadiazol-5-yl)methyl]-2-methyl-5-(tetrazol-1-yl)aniline is sourced from PubChem (CID 47066552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).