C18H11Cl2F2NO4 — CID 47066840
(2,3-difluorophenyl)methyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 47066840) has the molecular formula C18H11Cl2F2NO4 and a molecular weight of 414.19 g/mol. Its IUPAC name is (2,3-difluorophenyl)methyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (2,3-difluorophenyl)methyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 47066840 |
| Molecular Formula | C18H11Cl2F2NO4 |
| Molecular Weight | 414.19 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | (2,3-difluorophenyl)methyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@@H](C(=O)OCc1cccc(F)c1F)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C18H11Cl2F2NO4/c1-8(18(26)27-7-9-3-2-4-14(21)15(9)22)23-16(24)10-5-12(19)13(20)6-11(10)17(23)25/h2-6,8H,7H2,1H3/t8-/m0/s1 |
| InChIKey | MITBZCMKFPXJEQ-QMMMGPOBSA-N |
| XLogP | 4.00 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.19 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|