C20H23N3O4 — CID 47068220
(E)-N-(2-cyclopentyloxyphenyl)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enamide (PubChem CID 47068220) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is (E)-N-(2-cyclopentyloxyphenyl)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enamide.
| Compound Name | (E)-N-(2-cyclopentyloxyphenyl)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 47068220 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (E)-N-(2-cyclopentyloxyphenyl)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enamide |
| SMILES | Cn1cc(/C=C/C(=O)Nc2ccccc2OC2CCCC2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C20H23N3O4/c1-22-13-14(19(25)23(2)20(22)26)11-12-18(24)21-16-9-5-6-10-17(16)27-15-7-3-4-8-15/h5-6,9-13,15H,3-4,7-8H2,1-2H3,(H,21,24)/b12-11+ |
| InChIKey | KJPHMWVRLYKSCA-VAWYXSNFSA-N |
| XLogP | 2.06 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|