1-(2,4-difluorophenyl)ethyl 4-(methylsulfonylmethyl)benzoate

C17H16F2O4S — CID 47069309

IUPAC1-(2,4-difluorophenyl)ethyl 4-(methylsulfonylmethyl)benzoate
SMILESCC(OC(=O)c1ccc(CS(C)(=O)=O)cc1)c1ccc(F)cc1F
InChIInChI=1S/C17H16F2O4S/c1-11(15-8-7-14(18)9-16(15)19)23-17(20)13-5-3-12(4-6-13)10-24(2,21)22/h3-9,11H,10H2,1-2H3
InChIKeyBQHSGPVNVDEVNP-UHFFFAOYSA-N
MW354.37 g/mol
LogP3.43
Rot. Bonds5

About 1-(2,4-difluorophenyl)ethyl 4-(methylsulfonylmethyl)benzoate

1-(2,4-difluorophenyl)ethyl 4-(methylsulfonylmethyl)benzoate (PubChem CID 47069309) has the molecular formula C17H16F2O4S and a molecular weight of 354.37 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)ethyl 4-(methylsulfonylmethyl)benzoate.

Molecular Properties

Compound Name1-(2,4-difluorophenyl)ethyl 4-(methylsulfonylmethyl)benzoate
PubChem CID47069309
Molecular FormulaC17H16F2O4S
Molecular Weight354.37 g/mol
Exact Mass354.07
IUPAC Name1-(2,4-difluorophenyl)ethyl 4-(methylsulfonylmethyl)benzoate
SMILESCC(OC(=O)c1ccc(CS(C)(=O)=O)cc1)c1ccc(F)cc1F
InChIInChI=1S/C17H16F2O4S/c1-11(15-8-7-14(18)9-16(15)19)23-17(20)13-5-3-12(4-6-13)10-24(2,21)22/h3-9,11H,10H2,1-2H3
InChIKeyBQHSGPVNVDEVNP-UHFFFAOYSA-N
XLogP3.43
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500354.37
LogP ≤ 53.43
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 1-(2,4-difluorophenyl)ethyl 4-(methylsulfonylmethyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,4-difluorophenyl)ethyl 4-(methylsulfonylmethyl)benzoate?
The IUPAC name of 1-(2,4-difluorophenyl)ethyl 4-(methylsulfonylmethyl)benzoate (CID 47069309) is 1-(2,4-difluorophenyl)ethyl 4-(methylsulfonylmethyl)benzoate.
What is the SMILES notation for 1-(2,4-difluorophenyl)ethyl 4-(methylsulfonylmethyl)benzoate?
The canonical SMILES for 1-(2,4-difluorophenyl)ethyl 4-(methylsulfonylmethyl)benzoate is CC(OC(=O)c1ccc(CS(C)(=O)=O)cc1)c1ccc(F)cc1F.
What is the InChIKey of 1-(2,4-difluorophenyl)ethyl 4-(methylsulfonylmethyl)benzoate?
The InChIKey is BQHSGPVNVDEVNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F2O4S/c1-11(15-8-7-14(18)9-16(15)19)23-17(20)13-5-3-12(4-6-13)10-24(2,21)22/h3-9,11H,10H2,1-2H3.
What are the key properties of 1-(2,4-difluorophenyl)ethyl 4-(methylsulfonylmethyl)benzoate?
1-(2,4-difluorophenyl)ethyl 4-(methylsulfonylmethyl)benzoate has a molecular weight of 354.37 g/mol, XLogP of 3.43, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-difluorophenyl)ethyl 4-(methylsulfonylmethyl)benzoate is sourced from PubChem (CID 47069309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).