C18H21NO6 — CID 47069980
methyl 5-[[[3-(2-methoxyethoxy)benzoyl]amino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 47069980) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is methyl 5-[[[3-(2-methoxyethoxy)benzoyl]amino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[[3-(2-methoxyethoxy)benzoyl]amino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 47069980 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | methyl 5-[[[3-(2-methoxyethoxy)benzoyl]amino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | COCCOc1cccc(C(=O)NCc2cc(C(=O)OC)c(C)o2)c1 |
| InChI | InChI=1S/C18H21NO6/c1-12-16(18(21)23-3)10-15(25-12)11-19-17(20)13-5-4-6-14(9-13)24-8-7-22-2/h4-6,9-10H,7-8,11H2,1-3H3,(H,19,20) |
| InChIKey | FWQJBMCIWNAMOC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|