About 6-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carbonitrile
6-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carbonitrile (PubChem CID 47070036) has the molecular formula C12H11N5S2
and a molecular weight of 289.39 g/mol. Its IUPAC name is 6-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carbonitrile |
| PubChem CID | 47070036 |
| Molecular Formula | C12H11N5S2 |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 6-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(Sc2nnc(N3CCCC3)s2)nc1 |
| InChI | InChI=1S/C12H11N5S2/c13-7-9-3-4-10(14-8-9)18-12-16-15-11(19-12)17-5-1-2-6-17/h3-4,8H,1-2,5-6H2 |
| InChIKey | DQUYKHQYAHVOSC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 65.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carbonitrile?
The IUPAC name of 6-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carbonitrile (CID 47070036) is 6-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carbonitrile.
What is the SMILES notation for 6-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carbonitrile?
The canonical SMILES for 6-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carbonitrile is N#Cc1ccc(Sc2nnc(N3CCCC3)s2)nc1.
What is the InChIKey of 6-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carbonitrile?
The InChIKey is DQUYKHQYAHVOSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5S2/c13-7-9-3-4-10(14-8-9)18-12-16-15-11(19-12)17-5-1-2-6-17/h3-4,8H,1-2,5-6H2.
What are the key properties of 6-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carbonitrile?
6-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carbonitrile has a molecular weight of 289.39 g/mol, XLogP of 2.56, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carbonitrile is sourced from PubChem (CID 47070036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).