C14H21NO4S — CID 47070193
N-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]ethanesulfonamide (PubChem CID 47070193) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is N-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]ethanesulfonamide.
| Compound Name | N-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 47070193 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCc1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C14H21NO4S/c1-2-20(16,17)15-10-12-5-7-13(8-6-12)19-11-14-4-3-9-18-14/h5-8,14-15H,2-4,9-11H2,1H3 |
| InChIKey | OKHKZJCSELVPMC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |