About N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-5-methylthiophene-2-carboxamide
N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-5-methylthiophene-2-carboxamide (PubChem CID 47071215) has the molecular formula C14H11FN4OS
and a molecular weight of 302.33 g/mol. Its IUPAC name is N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-5-methylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-5-methylthiophene-2-carboxamide |
| PubChem CID | 47071215 |
| Molecular Formula | C14H11FN4OS |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(-n3cncn3)c(F)c2)s1 |
| InChI | InChI=1S/C14H11FN4OS/c1-9-2-5-13(21-9)14(20)18-10-3-4-12(11(15)6-10)19-8-16-7-17-19/h2-8H,1H3,(H,18,20) |
| InChIKey | AWWKEMLMSWULEU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-5-methylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-5-methylthiophene-2-carboxamide?
The IUPAC name of N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-5-methylthiophene-2-carboxamide (CID 47071215) is N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-5-methylthiophene-2-carboxamide.
What is the SMILES notation for N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-5-methylthiophene-2-carboxamide?
The canonical SMILES for N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-5-methylthiophene-2-carboxamide is Cc1ccc(C(=O)Nc2ccc(-n3cncn3)c(F)c2)s1.
What is the InChIKey of N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-5-methylthiophene-2-carboxamide?
The InChIKey is AWWKEMLMSWULEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11FN4OS/c1-9-2-5-13(21-9)14(20)18-10-3-4-12(11(15)6-10)19-8-16-7-17-19/h2-8H,1H3,(H,18,20).
What are the key properties of N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-5-methylthiophene-2-carboxamide?
N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-5-methylthiophene-2-carboxamide has a molecular weight of 302.33 g/mol, XLogP of 3.03, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-5-methylthiophene-2-carboxamide is sourced from PubChem (CID 47071215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).