C18H24N4OS — CID 47071729
N-(3-phenylpropyl)-4-(1,3-thiazol-4-ylmethyl)piperazine-1-carboxamide (PubChem CID 47071729) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is N-(3-phenylpropyl)-4-(1,3-thiazol-4-ylmethyl)piperazine-1-carboxamide.
| Compound Name | N-(3-phenylpropyl)-4-(1,3-thiazol-4-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 47071729 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-(3-phenylpropyl)-4-(1,3-thiazol-4-ylmethyl)piperazine-1-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)N1CCN(Cc2cscn2)CC1 |
| InChI | InChI=1S/C18H24N4OS/c23-18(19-8-4-7-16-5-2-1-3-6-16)22-11-9-21(10-12-22)13-17-14-24-15-20-17/h1-3,5-6,14-15H,4,7-13H2,(H,19,23) |
| InChIKey | NRTUXOHERSFHEK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|