C8H12ClNO2S2 — CID 47071854
N-[(5-chlorothiophen-2-yl)methyl]propane-1-sulfonamide (PubChem CID 47071854) has the molecular formula C8H12ClNO2S2 and a molecular weight of 253.78 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]propane-1-sulfonamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 47071854 |
| Molecular Formula | C8H12ClNO2S2 |
| Molecular Weight | 253.78 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCc1ccc(Cl)s1 |
| InChI | InChI=1S/C8H12ClNO2S2/c1-2-5-14(11,12)10-6-7-3-4-8(9)13-7/h3-4,10H,2,5-6H2,1H3 |
| InChIKey | BIYBASVPGGSBTO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.78 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |