About N-[3-chloro-4-(4-propylpiperazin-1-yl)phenyl]tetrazolo[1,5-b]pyridazin-6-amine
N-[3-chloro-4-(4-propylpiperazin-1-yl)phenyl]tetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 47072366) has the molecular formula C17H21ClN8
and a molecular weight of 372.86 g/mol. Its IUPAC name is N-[3-chloro-4-(4-propylpiperazin-1-yl)phenyl]tetrazolo[1,5-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | N-[3-chloro-4-(4-propylpiperazin-1-yl)phenyl]tetrazolo[1,5-b]pyridazin-6-amine |
| PubChem CID | 47072366 |
| Molecular Formula | C17H21ClN8 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | N-[3-chloro-4-(4-propylpiperazin-1-yl)phenyl]tetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | CCCN1CCN(c2ccc(Nc3ccc4nnnn4n3)cc2Cl)CC1 |
| InChI | InChI=1S/C17H21ClN8/c1-2-7-24-8-10-25(11-9-24)15-4-3-13(12-14(15)18)19-16-5-6-17-20-22-23-26(17)21-16/h3-6,12H,2,7-11H2,1H3,(H,19,21) |
| InChIKey | GIVBHTVAPLFKRS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze N-[3-chloro-4-(4-propylpiperazin-1-yl)phenyl]tetrazolo[1,5-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-chloro-4-(4-propylpiperazin-1-yl)phenyl]tetrazolo[1,5-b]pyridazin-6-amine?
The IUPAC name of N-[3-chloro-4-(4-propylpiperazin-1-yl)phenyl]tetrazolo[1,5-b]pyridazin-6-amine (CID 47072366) is N-[3-chloro-4-(4-propylpiperazin-1-yl)phenyl]tetrazolo[1,5-b]pyridazin-6-amine.
What is the SMILES notation for N-[3-chloro-4-(4-propylpiperazin-1-yl)phenyl]tetrazolo[1,5-b]pyridazin-6-amine?
The canonical SMILES for N-[3-chloro-4-(4-propylpiperazin-1-yl)phenyl]tetrazolo[1,5-b]pyridazin-6-amine is CCCN1CCN(c2ccc(Nc3ccc4nnnn4n3)cc2Cl)CC1.
What is the InChIKey of N-[3-chloro-4-(4-propylpiperazin-1-yl)phenyl]tetrazolo[1,5-b]pyridazin-6-amine?
The InChIKey is GIVBHTVAPLFKRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClN8/c1-2-7-24-8-10-25(11-9-24)15-4-3-13(12-14(15)18)19-16-5-6-17-20-22-23-26(17)21-16/h3-6,12H,2,7-11H2,1H3,(H,19,21).
What are the key properties of N-[3-chloro-4-(4-propylpiperazin-1-yl)phenyl]tetrazolo[1,5-b]pyridazin-6-amine?
N-[3-chloro-4-(4-propylpiperazin-1-yl)phenyl]tetrazolo[1,5-b]pyridazin-6-amine has a molecular weight of 372.86 g/mol, XLogP of 2.45, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-chloro-4-(4-propylpiperazin-1-yl)phenyl]tetrazolo[1,5-b]pyridazin-6-amine is sourced from PubChem (CID 47072366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).