C12H11Cl3N2O3 — CID 47072562
3-(2-oxo-1,3-oxazolidin-3-yl)-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 47072562) has the molecular formula C12H11Cl3N2O3 and a molecular weight of 337.59 g/mol. Its IUPAC name is 3-(2-oxo-1,3-oxazolidin-3-yl)-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | 3-(2-oxo-1,3-oxazolidin-3-yl)-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 47072562 |
| Molecular Formula | C12H11Cl3N2O3 |
| Molecular Weight | 337.59 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 3-(2-oxo-1,3-oxazolidin-3-yl)-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | O=C(CCN1CCOC1=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl3N2O3/c13-7-5-9(15)10(6-8(7)14)16-11(18)1-2-17-3-4-20-12(17)19/h5-6H,1-4H2,(H,16,18) |
| InChIKey | UYXITLMODQEAGK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|