About 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-6-oxopyridine-3-carboxamide
1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-6-oxopyridine-3-carboxamide (PubChem CID 47073248) has the molecular formula C15H19N3O2S
and a molecular weight of 305.40 g/mol. Its IUPAC name is 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-6-oxopyridine-3-carboxamide.
Molecular Properties
| Compound Name | 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-6-oxopyridine-3-carboxamide |
| PubChem CID | 47073248 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-6-oxopyridine-3-carboxamide |
| SMILES | CNC(=O)c1ccc(=O)n(Cc2csc(C(C)(C)C)n2)c1 |
| InChI | InChI=1S/C15H19N3O2S/c1-15(2,3)14-17-11(9-21-14)8-18-7-10(13(20)16-4)5-6-12(18)19/h5-7,9H,8H2,1-4H3,(H,16,20) |
| InChIKey | DZYZQKSMGMKUNG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-6-oxopyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-6-oxopyridine-3-carboxamide?
The IUPAC name of 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-6-oxopyridine-3-carboxamide (CID 47073248) is 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-6-oxopyridine-3-carboxamide.
What is the SMILES notation for 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-6-oxopyridine-3-carboxamide?
The canonical SMILES for 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-6-oxopyridine-3-carboxamide is CNC(=O)c1ccc(=O)n(Cc2csc(C(C)(C)C)n2)c1.
What is the InChIKey of 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-6-oxopyridine-3-carboxamide?
The InChIKey is DZYZQKSMGMKUNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O2S/c1-15(2,3)14-17-11(9-21-14)8-18-7-10(13(20)16-4)5-6-12(18)19/h5-7,9H,8H2,1-4H3,(H,16,20).
What are the key properties of 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-6-oxopyridine-3-carboxamide?
1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-6-oxopyridine-3-carboxamide has a molecular weight of 305.40 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-6-oxopyridine-3-carboxamide is sourced from PubChem (CID 47073248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).