C19H30N4O2S — CID 47073373
N-(cyclohexylcarbamoyl)-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]acetamide (PubChem CID 47073373) has the molecular formula C19H30N4O2S and a molecular weight of 378.54 g/mol. Its IUPAC name is N-(cyclohexylcarbamoyl)-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]acetamide.
| Compound Name | N-(cyclohexylcarbamoyl)-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 47073373 |
| Molecular Formula | C19H30N4O2S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | N-(cyclohexylcarbamoyl)-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(CCc2cccs2)CC1)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C19H30N4O2S/c24-18(21-19(25)20-16-5-2-1-3-6-16)15-23-12-10-22(11-13-23)9-8-17-7-4-14-26-17/h4,7,14,16H,1-3,5-6,8-13,15H2,(H2,20,21,24,25) |
| InChIKey | YQNHQLAUPFPWMZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |